![[ICO]](/icons/blank.gif) | Name | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | |
![[ ]](/icons/unknown.gif) | D-Day (1984)(Games Workshop).tzx | 95K | |
| D-Day (1984)(Games Workshop)[a2].tzx | 95K | |
| D-Day (1984)(Games Workshop)[a].tzx | 127K | |
| D Day (1984)(Games Workshop).tzx | 95K | |
| D_N_A_ Warrior (1989)(Cascade Games)(128k).tzx | 51K | |
| D_N_A_ Warrior (1989)(Cascade Games).tzx | 51K | |
| D_N_A_ Warrior (1989)(MCM Software)(128k)[re-release].tzx | 52K | |
| D_N_A_ Warrior (1989)(MCM Software)[re-release].tzx | 52K | |
| Daemon (19xx)(Delta 3 Software).tzx | 42K | |
| Daemon (19xx)(Global Games)[re-release].tzx | 42K | |
| Daley Thompson's Decathlon - Day 1 (1984)(Ocean Software).tzx | 49K | |
| Daley Thompson's Decathlon - Day 1 (1984)(Ocean Software)[a2].tzx | 49K | |
| Daley Thompson's Decathlon - Day 1 (1984)(Ocean Software)[a].tzx | 49K | |
| Daley Thompson's Decathlon - Day 1 (1984)(Ocean Software)[a][small ..> | 49K | |
| Daley Thompson's Decathlon - Day 1 (1984)(Ocean Software)[large cas..> | 49K | |
| Daley Thompson's Decathlon - Day 1 (1984)(Ocean Software)[small cas..> | 49K | |
| Daley Thompson's Decathlon - Day 1 (1984)(The Hit Squad)[re-release..> | 53K | |
| Daley Thompson's Decathlon - Day 1 (1984)(Zafiro Software Division)..> | 49K | |
| Daley Thompson's Decathlon - Day 2 (1984)(Ocean Software).tzx | 49K | |
| Daley Thompson's Decathlon - Day 2 (1984)(Ocean Software)[a2].tzx | 49K | |
| Daley Thompson's Decathlon - Day 2 (1984)(Ocean Software)[a].tzx | 49K | |
| Daley Thompson's Decathlon - Day 2 (1984)(Ocean Software)[a][small ..> | 49K | |
| Daley Thompson's Decathlon - Day 2 (1984)(Ocean Software)[large cas..> | 49K | |
| Daley Thompson's Decathlon - Day 2 (1984)(Ocean Software)[small cas..> | 49K | |
| Daley Thompson's Decathlon - Day 2 (1984)(The Hit Squad)[re-release..> | 54K | |
| Daley Thompson's Decathlon - Day 2 (1984)(Zafiro Software Division)..> | 49K | |
| Daley Thompson's Olympic Challenge (1988)(Erbe Software)(Side A)[re..> | 118K | |
| Daley Thompson's Olympic Challenge (1988)(Erbe Software)(Side B)[re..> | 107K | |
| Daley Thompson's Olympic Challenge (1988)(Ocean Software).tzx | 233K | |
| Daley Thompson's Olympic Challenge (1988)(Ocean Software)[a2][Speed..> | 232K | |
| Daley Thompson's Olympic Challenge (1988)(Ocean Software)[a].tzx | 123K | |
| Daley Thompson's Supertest (1985)(Investronica)(128k)(es)[re-releas..> | 126K | |
| Daley Thompson's Supertest (1985)(Ocean Software)(128k).tzx | 125K | |
| Daley Thompson's Supertest (1985)(Ocean Software)(128k)[a2].tzx | 125K | |
| Daley Thompson's Supertest (1985)(Ocean Software)(128k)[a3].tzx | 125K | |
| Daley Thompson's Supertest (1985)(Ocean Software)(128k)[a].tzx | 125K | |
| Daley Thompson's Supertest (1985)(The Hit Squad)(128k)[re-release].tzx | 127K | |
| Daley Thompson's Supertest (1985)(The Hit Squad)[re-release].tzx | 103K | |
| Daley Thompson's Supertest (1989)(Erbe Software)(128k)(es)[re-relea..> | 141K | |
| Daley Thompson's Supertest - Day 1 (1985)(Ocean Software).tzx | 49K | |
| Daley Thompson's Supertest - Day 1 (1985)(Ocean Software)[a].tzx | 53K | |
| Daley Thompson's Supertest - Day 1 (1985)(Ocean Software)[cr Vatros..> | 48K | |
| Daley Thompson's Supertest - Day 1 (1988)(Erbe Software)[re-release..> | 49K | |
| Daley Thompson's Supertest - Day 2 (1985)(Ocean Software).tzx | 50K | |
| Daley Thompson's Supertest - Day 2 (1985)(Ocean Software)[a].tzx | 61K | |
| Daley Thompson's Supertest - Day 2 (1985)(Ocean Software)[cr Vatros..> | 48K | |
| Daley Thompson's Supertest - Day 2 (1988)(Erbe Software)[re-release..> | 49K | |
| Dallas (1982)(CCS).tzx | 21K | |
| Dallas (1982)(CCS)[a2].tzx | 13K | |
| Dallas (1982)(CCS)[a].tzx | 13K | |
| Dam Busters, The (1985)(The Power House)[re-release].tzx | 49K | |
| Dam Busters, The (1985)(US Gold).tzx | 50K | |
| Dama (19xx)(-)(ru).tzx | 8.3K | |
| Damas Rev (19xx)(-)(es).tzx | 7.0K | |
| Dame (19xx)(-)(16k)(de).tzx | 7.3K | |
| Dame (19xx)(-)(16k).tzx | 5.1K | |
| Dame de Monsoreau, La (1987)(IKO & RGSoft)(cz).tzx | 34K | |
| Dame de Monsoreau, La (1987)(IKO & RGSoft)(cz)[a].tzx | 34K | |
| Damned Forest, The (1988)(Cult Games).tzx | 47K | |
| Damned Forest, The (1988)(Cult Games)[a].tzx | 47K | |
| Dan Dare - Pilot of the Future (1986)(Ricochet)[re-release].tzx | 46K | |
| Dan Dare - Pilot of the Future (1986)(Virgin Games).tzx | 47K | |
| Dan Dare - Pilot of the Future (1986)(Virgin Games)[a2].tzx | 47K | |
| Dan Dare - Pilot of the Future (1986)(Virgin Games)[a].tzx | 34K | |
| Dan Dare - Pilot of the Future (1988)(Dro Soft)[re-release].tzx | 46K | |
| Dan Dare II - Mekon's Revenge (1988)(Ricochet)[re-release].tzx | 45K | |
| Dan Dare II - Mekon's Revenge (1988)(Virgin Games).tzx | 34K | |
| Dan Dare II - Mekon's Revenge (1988)(Virgin Games)[a].tzx | 56K | |
| Dan Dare III - The Escape (1990)(Dro Soft)[re-release].tzx | 47K | |
| Dan Dare III - The Escape (1990)(Virgin Games).tzx | 33K | |
| Dan Dare III - The Escape (1990)(Virgin Games)[a2].tzx | 52K | |
| Dan Dare III - The Escape (1990)(Virgin Games)[a].tzx | 53K | |
| Dandy (1986)(Electric Dreams Software).tzx | 84K | |
| Dandy (1986)(Electric Dreams Software)[a2].tzx | 84K | |
| Dandy (1986)(Electric Dreams Software)[a3].tzx | 84K | |
| Dandy (1986)(Electric Dreams Software)[a].tzx | 84K | |
| Dandy (1986)(Electric Dreams Software)[h].tzx | 84K | |
| Danger! Adventurer at Work! (1991)(The Guild).tzx | 36K | |
| Danger! Adventurer at Work! (1991)(The Guild)[a].tzx | 36K | |
| Danger! Adventurer at Work! 2 (1992)(The Guild).tzx | 40K | |
| Danger (1987)(Jorge Perez Barreiro)(es).tzx | 31K | |
| Danger Mouse in Double Trouble (1984)(Alternative Software)[re-rele..> | 48K | |
| Danger Mouse in Double Trouble (1984)(Creative Sparks).tzx | 47K | |
| Danger Mouse in Double Trouble (1984)(Creative Sparks)[a].tzx | 48K | |
| Danger Mouse in Double Trouble (1986)(Sparklers)[re-release].tzx | 48K | |
| Danger Mouse in Making Whoopee! (1985)(Alternative Software)[re-rel..> | 36K | |
| Danger Mouse in Making Whoopee! (1985)(Creative Sparks).tzx | 36K | |
| Danger Mouse in Making Whoopee! (1985)(Sparklers)[re-release].tzx | 36K | |
| Danger Mouse in Making Whoopee! (1988)(System 4)[re-release].tzx | 36K | |
| Danger Mouse in The Black Forest Chateau (1984)(Alternative Softwar..> | 34K | |
| Danger Mouse in The Black Forest Chateau (1984)(Alternative Softwar..> | 32K | |
| Danger Mouse in The Black Forest Chateau (1984)(Creative Sparks)(Si..> | 34K | |
| Danger Mouse in The Black Forest Chateau (1984)(Creative Sparks)(Si..> | 34K | |
| Danger Mouse in The Black Forest Chateau (1984)(Creative Sparks)(Si..> | 30K | |
| Danger Mouse in The Black Forest Chateau (1984)(Creative Sparks)(Si..> | 36K | |
| Danger Street (1990)(Manuel Soft)(cz).tzx | 30K | |
| Dangerous Gardens (1984)(CV Software).tzx | 37K | |
| Dargon's Crypt (1987)(Venom Games).tzx | 32K | |
| Darius (1990)(The Edge Software)[t].tzx | 215K | |
| Dark Empire (1987)(MC Lothlorien).tzx | 48K | |
| Dark Empire (1987)(MC Lothlorien)[a].tzx | 48K | |
| Dark Fusion (1988)(Erbe Software)[re-release].tzx | 64K | |
| Dark Fusion (1988)(Gremlin Graphics Software).tzx | 64K | |
| Dark Fusion (1988)(Gremlin Graphics Software)[a].tzx | 64K | |
| Dark Gladiator, The (1993)(FSF Adventures)(128k).tzx | 63K | |
| Dark Sceptre (1987)(Firebird Software).tzx | 61K | |
| Dark Sceptre (1987)(Firebird Software)[a].tzx | 44K | |
| Dark Side (1988)(Incentive Software).tzx | 48K | |
| Dark Sky over Paradise v1_1 (1990)(Interactive Technology).tzx | 79K | |
| Dark Star (1985)(Design Design Software).tzx | 89K | |
| Dark Star (1985)(Firebird Software)[re-release].tzx | 45K | |
| Dark Storm (1989)(Global Games).tzx | 35K | |
| Dark Tower, The (1992)(River Software).tzx | 43K | |
| Dark Tower, The (1992)(River Software)[a].tzx | 43K | |
| Dark Tower, The (1992)(Zenobi Software)[a][re-release].tzx | 39K | |
| Dark Tower, The (1992)(Zenobi Software)[re-release].tzx | 39K | |
| Darkest Road (1991)(Zenobi Software).tzx | 39K | |
| Darkest Road II - 'Twas a Time of Dread (1991)(Zenobi Software).tzx | 39K | |
| Darkest Road III - The Unborn One (1991)(Zenobi Software).tzx | 38K | |
| Darkman (1991)(Erbe Software)(128k)(Side A)[re-release].tzx | 102K | |
| Darkman (1991)(Erbe Software)(128k)(Side B)[re-release].tzx | 77K | |
| Darkman (1991)(Ocean Software)(128k).tzx | 178K | |
| Darts (1982)(Mr_ Chip Software).tzx | 35K | |
| Dartz (1984)(Automata UK).tzx | 44K | |
| David el Gnomo (1986)(Compulogical)(es).tzx | 46K | |
| Dawnssley (1987)(Top Ten Software).tzx | 19K | |
| Day Trip (19xx)(-).tzx | 12K | |
| Day of the Match (1984)(Video Software).tzx | 49K | |
| Days of Thunder (1990)(Mindscape International)(128k).tzx | 86K | |
| Days of Thunder (1990)(Mindscape International).tzx | 86K | |
| Deactivators (1986)(Firebird Software)[re-release].tzx | 50K | |
| Deactivators (1986)(Reaktor)(128k).tzx | 53K | |
| Deactivators (1986)(Reaktor)(128k)[a2].tzx | 53K | |
| Deactivators (1986)(Reaktor)(128k)[a].tzx | 53K | |
| Deactivators (1986)(Reaktor).tzx | 43K | |
| Deactivators (1986)(Reaktor)[BleepLoad].tzx | 50K | |
| Deactivators (1986)(Reaktor)[a][BleepLoad].tzx | 50K | |
| Dead End (1990)(Interactive Technology).tzx | 103K | |
| Deadenders (1989)(Top Ten Software).tzx | 40K | |
| Deadly Evil (1990)(Players Premier Software)(48-128k).tzx | 47K | |
| Deadly Mission (1987)(John Henry Enterprises).tzx | 41K | |
| Deadly Mission (1987)(John Henry Enterprises)[a].tzx | 16K | |
| Deadly Silence (1991)(Elven Adventurers).tzx | 35K | |
| Dead or Alive (1987)(Alternative Software).tzx | 48K | |
| Dead or Alive (1987)(Alternative Software)[a].tzx | 48K | |
| Deadringer (1987)(Reaktor).tzx | 48K | |
| Deadringer (1987)(Reaktor)[SpeedLock 4].tzx | 45K | |
| Death Before Dishonour (1987)(Alternative Software).tzx | 21K | |
| Death Before Dishonour (1987)(Alternative Software)[a].tzx | 36K | |
| Death Before Dishonour (1988)(System 4)[re-release].tzx | 36K | |
| Death Bringer (19xx)(The Guild).tzx | 42K | |
| Death Chess 5000 (1984)(Artic Computing).tzx | 40K | |
| Death Cruiser (1983)(Noble House Software).tzx | 31K | |
| Death Stalker (1988)(Codemasters).tzx | 50K | |
| Death Stalker (1988)(Codemasters)[a].tzx | 50K | |
| Death Star (1984)(Rabbit Software).tzx | 19K | |
| Death Star (1984)(Rabbit Software)[a].tzx | 19K | |
| Death Star Interceptor (1985)(System 3 Software).tzx | 49K | |
| Death Wake (1985)(Bug-Byte Software)[re-release].tzx | 47K | |
| Death Wake (1985)(Quicksilva).tzx | 47K | |
| Death Wake (1985)(Quicksilva)[a2].tzx | 46K | |
| Death Wake (1985)(Quicksilva)[a].tzx | 47K | |
| Death Wish 3 (1986)(Gremlin Graphics Software)(48-128k)[cr].tzx | 49K | |
| Death Wish 3 (1987)(Erbe Software)(48-128k)[a][re-release].tzx | 53K | |
| Death Wish 3 (1987)(Erbe Software)(48-128k)[re-release].tzx | 53K | |
| Death Wish 3 (1987)(Gremlin Graphics Software)(48-128k).tzx | 53K | |
| Death Wish 3 (1987)(Gremlin Graphics Software)(48-128k)[a].tzx | 53K | |
| Deathball 2000 (1986)(Alpha-Omega Software).tzx | 47K | |
| Deathball 2000 (1986)(Alpha-Omega Software)[a].tzx | 47K | |
| Deathchase (1983)(2_99)[re-release].tzx | 32K | |
| Deathchase (1983)(Micromega).tzx | 16K | |
| Deathchase (1983)(Micromega)[a2].tzx | 16K | |
| Deathchase (1983)(Micromega)[a3].tzx | 16K | |
| Deathchase (1983)(Micromega)[a4].tzx | 6.8K | |
| Deathchase (1983)(Micromega)[a].tzx | 16K | |
| Deathchase (1983)(Zeppelin Games)[re-release].tzx | 17K | |
| Deathchase (1989)(Zeppelin Games)[master tape].tzx | 17K | |
| Death in Russia 1941 (1986)(MC Lothlorien).tzx | 41K | |
| Death or Glory (1987)(CRL Group).tzx | 47K | |
| Death or Glory (1987)(CRL Group)[a].tzx | 47K | |
| Death or Glory (1993)(Dream World Adventures)(Side A).tzx | 39K | |
| Death or Glory (1993)(Dream World Adventures)(Side B).tzx | 38K | |
| Deathscape (1987)(Starlight Software).tzx | 45K | |
| Deathscape (1987)(Starlight Software)[a2].tzx | 45K | |
| Deathscape (1987)(Starlight Software)[a].tzx | 45K | |
| Decor Wreckers (1984)(Scorpio Software).tzx | 20K | |
| Decor Wreckers (1984)(Scorpio Software)[a].tzx | 20K | |
| Deek's Deeds (1990)(Bass-On).tzx | 41K | |
| Deek's Deeds (1991)(Zenobi Software)[a][re-release].tzx | 38K | |
| Deek's Deeds (1991)(Zenobi Software)[re-release].tzx | 38K | |
| Deep, The (1988)(US Gold).tzx | 79K | |
| Deep, The (1988)(US Gold)[t].tzx | 74K | |
| Deep Scan (2005)(OCTOCOM)(es).tzx | 31K | |
| Deep Space (1984)(Kryptronic)[re-release].tzx | 27K | |
| Deep Space (1984)(PSS).tzx | 27K | |
| Deep Strike (1986)(Durell Software).tzx | 43K | |
| Deep Strike (1986)(Durell Software)[cr Blood].tzx | 30K | |
| Deep Strike (1986)(Encore)[re-release].tzx | 43K | |
| Deep Strike (1986)(Erbe Software)[re-release].tzx | 49K | |
| Defcom (1986)(Quicksilva).tzx | 48K | |
| Defcom (1986)(Quicksilva)[a2].tzx | 48K | |
| Defcom (1986)(Quicksilva)[a].tzx | 48K | |
| Defcom 1 (1989)(Iber Soft)(es)(Side A).tzx | 88K | |
| Defcom 1 (1989)(Iber Soft)(es)(Side B).tzx | 46K | |
| Defcom 1 (1989)(Iber Soft)(es).tzx | 133K | |
| Defence (19xx)(Robert Gay)(16k)(es).tzx | 5.4K | |
| Defenda (1984)(Interstella Software).tzx | 13K | |
| Defenda (1984)(Interstella Software)[a].tzx | 16K | |
| Defendar (1984)(Mikro-Gen).tzx | 14K | |
| Defender of the Crown (1989)(The Cat).tzx | 61K | |
| Defenders of the Earth (1990)(Enigma Variations)(48-128k)(Side A).tzx | 32K | |
| Defenders of the Earth (1990)(Enigma Variations)(48-128k)(Side B).tzx | 64K | |
| Defenders of the Earth (1990)(Enigma Variations)(48-128k).tzx | 96K | |
| Defenders of the Earth (1990)(Enigma Variations)(128k).tzx | 90K | |
| Defenders of the Earth (1990)(Hi-Tec Software)(48-128k)(Side A)[re-..> | 32K | |
| Defenders of the Earth (1990)(Hi-Tec Software)(48-128k)(Side B)[re-..> | 64K | |
| Deflektor (1987)(Erbe Software)[re-release].tzx | 57K | |
| Deflektor (1987)(Gremlin Graphics Software).tzx | 57K | |
| Deflektor (1987)(Gremlin Graphics Software)[a].tzx | 57K | |
| Defusion (1984)(K-Tel Productions).tzx | 28K | |
| Dekorating Blues (1986)(Alpha-Omega Software)(Side A).tzx | 52K | |
| Dekorating Blues (1986)(Alpha-Omega Software)(Side B).tzx | 52K | |
| Delfox (1988)(Dinamic Software)(es).tzx | 18K | |
| Delfox (1988)(Dinamic Software)(es)[a2].tzx | 18K | |
| Delfox (1988)(Dinamic Software)(es)[a].tzx | 18K | |
| Deliverer 2 - Escape to Eskelos (1987)(Brian Parks).tzx | 48K | |
| Delta Charge (1990)(Thalamus)(128k).tzx | 48K | |
| Delta Charge (1990)(Thalamus).tzx | 48K | |
| Delta Wing - 1 Player (1984)(Creative Sparks)(Side A).tzx | 47K | |
| Delta Wing - 1 Player (1984)(Creative Sparks)(Side A)[a].tzx | 50K | |
| Delta Wing - 1 Player (1986)(Mastertronic Added Dimension)[a][re-re..> | 50K | |
| Delta Wing - 1 Player (1986)(Mastertronic Added Dimension)[re-relea..> | 50K | |
| Delta Wing - 2 Players (1984)(Creative Sparks)(Side B).tzx | 44K | |
| Delta Wing - 2 Players (1984)(Creative Sparks)(Side B)[a].tzx | 46K | |
| Delta Wing - 2 Players (1986)(Mastertronic Added Dimension)[a][re-r..> | 46K | |
| Delta Wing - 2 Players (1986)(Mastertronic Added Dimension)[re-rele..> | 50K | |
| Demi-God (1989)(Softel Software).tzx | 47K | |
| Demi-God (1991)(Zenobi Software)[re-release].tzx | 43K | |
| Demolition (1984)(Dorling Kindersley Software)(de).tzx | 13K | |
| Demolition (1984)(Dorling Kindersley Software).tzx | 14K | |
| Demon's Revenge (1988)(Firebird Software).tzx | 59K | |
| Demon's Revenge (1988)(MCM Software)[re-release].tzx | 59K | |
| Demon-Driver (1983)(Swap)(de).tzx | 8.1K | |
| Demon Knight (1983)(ASP Software).tzx | 24K | |
| Demon Knight (1983)(ASP Software)[a].tzx | 24K | |
| Demon Knight (1983)(Forward Software)[re-release].tzx | 24K | |
| Demon Lord - Part 1 - Fortress of Fear (1984)(Mansfield Computers &..> | 47K | |
| Demon Lord - Part 2 - Forbidden Forest (1984)(Mansfield Computers &..> | 47K | |
| Demon from the Darkside (1986)(Compass Software).tzx | 47K | |
| Demon from the Darkside (1986)(Compass Software)[a2].tzx | 47K | |
| Demon from the Darkside (1986)(Compass Software)[a].tzx | 47K | |
| Demon from the Darkside II - The Golden Mask (1987)(Compass Softwar..> | 47K | |
| Demon from the Darkside II - The Golden Mask (1987)(Compass Softwar..> | 48K | |
| Demon from the Darkside II - The Golden Mask (1987)(Compass Softwar..> | 47K | |
| Demon from the Darkside III - The Devil's Hand (1988)(Compass Softw..> | 47K | |
| Demon from the Darkside III - The Devil's Hand (1988)(Compass Softw..> | 47K | |
| Demon from the Darkside III - The Devil's Hand (1988)(Compass Softw..> | 47K | |
| Demon from the Darkside IV - Shadows of the Past (1988)(Compass Sof..> | 43K | |
| Demon from the Darkside IV - Shadows of the Past (1988)(Compass Sof..> | 42K | |
| Demon from the Darkside IV - Shadows of the Past (1988)(Compass Sof..> | 42K | |
| Demon from the Darkside IV - Shadows of the Past (1988)(Compass Sof..> | 42K | |
| Demon from the Darkside IV - Shadows of the Past (1988)(Compass Sof..> | 43K | |
| Demonslair (1987)(Gadtek Games).tzx | 42K | |
| Denis through the Drinking Glass (1983)(Applications Software Speci..> | 40K | |
| Denis through the Drinking Glass (1983)(Applications Software Speci..> | 40K | |
| Denizen (1988)(Players Software)(128k).tzx | 110K | |
| Denizen (1988)(Players Software)(128k)[a].tzx | 110K | |
| Denizen (1988)(Players Software).tzx | 89K | |
| Denizen (1988)(Players Software)[a2].tzx | 46K | |
| Denizen (1988)(Players Software)[a].tzx | 89K | |
| Depot Master Finsbury Park (1989)(Ashley Greenup).tzx | 27K | |
| Derby Day (1982)(CRL Group).tzx | 36K | |
| Derby Day (1982)(CRL Group)[a].tzx | 36K | |
| Dervish (1988)(The Power House).tzx | 34K | |
| Desafio Total (1991)(Erbe Software)(128k)[aka Total Recall].tzx | 132K | |
| Descent (1995)(7 Gods).tzx | 44K | |
| Desert Burner (1985)(Sparklers).tzx | 45K | |
| Desert Island (1991)(G_I_ Games).tzx | 30K | |
| Desert Patrol (1982)(CRL Group).tzx | 6.4K | |
| Desert Rats (1985)(CCS)(128k).tzx | 93K | |
| Designer's Pencil, The (1984)(Activision).tzx | 33K | |
| Designer's Pencil, The (1984)(Activision)[a].tzx | 42K | |
| Desmond and Gertrude (1991)(Delbert the Hamster Software).tzx | 43K | |
| Desolator (1988)(Erbe Software)(48-128k)(Side A)[re-release].tzx | 53K | |
| Desolator (1988)(Erbe Software)(48-128k)(Side B)[re-release].tzx | 38K | |
| Desolator (1988)(US Gold)(48-128k).tzx | 96K | |
| Desolator (1988)(US Gold)(48-128k)[a].tzx | 96K | |
| Desperado (1986)(Central Solutions).tzx | 39K | |
| Desperado (1986)(Central Solutions)[a].tzx | 39K | |
| Desperado (1987)(Topo Soft)(es)(Side A).tzx | 35K | |
| Desperado (1987)(Topo Soft)(es)(Side B).tzx | 137K | |
| Desperado (1987)(Topo Soft)(es).tzx | 172K | |
| Desperado (1987)(Topo Soft)(es)[a2].tzx | 171K | |
| Desperado (1987)(Topo Soft)(es)[a3].tzx | 171K | |
| Desperado (1987)(Topo Soft)(es)[a].tzx | 171K | |
| Desperado 2 (1991)(Topo Soft)(es)(Side A).tzx | 49K | |
| Desperado 2 (1991)(Topo Soft)(es)(Side B).tzx | 48K | |
| Desperado 2 (1991)(Topo Soft)(es).tzx | 99K | |
| Destroyer (1983)(Abacus Programs)(16k).tzx | 7.1K | |
| Destroyer (1983)(Impact Software).tzx | 5.1K | |
| Destruction of the Galactic Empire, The (1984)(David Ashton - Grant..> | 32K | |
| Destruction of the Galactic Empire, The (1984)(David Ashton - Grant..> | 32K | |
| Destructor (19xx)(-)(16k)(es).tzx | 4.7K | |
| Detective (1983)(ASP Software).tzx | 13K | |
| Detective (1983)(Forward Software)[re-release].tzx | 14K | |
| Detective, The (1983)(Arcade Software).tzx | 23K | |
| Detective, The (1983)(Arcade Software)[a].tzx | 23K | |
| Detornator (1988)(Impact Software).tzx | 30K | |
| Deus Ex Machina (1984)(Automata UK).tzx | 43K | |
| Deus Ex Machina (1984)(Automata UK)[a].tzx | 82K | |
| Devastating Blow - 1 Player (1991)(Beyond Belief).tzx | 41K | |
| Devastating Blow - 2 Players (1991)(Beyond Belief).tzx | 41K | |
| Deviants (1987)(Players Software)(48-128k).tzx | 50K | |
| Deviants (1987)(Players Software)(48-128k)[a2].tzx | 50K | |
| Deviants (1987)(Players Software)(48-128k)[a].tzx | 50K | |
| Devil's Crown, The (1985)(Mastertronic).tzx | 47K | |
| Devil's Crown, The (1985)(Mastertronic)[a].tzx | 47K | |
| Devil's Descent, The (1987)(Video Vault)[re-release].tzx | 47K | |
| Devil's Hand, The (1988)(Compass Software)[master tape].tzx | 47K | |
| Devil's Island (1983)(Gilsoft International).tzx | 33K | |
| Devil's Island (1983)(Gilsoft International)[a2].tzx | 33K | |
| Devil's Island (1983)(Gilsoft International)[a].tzx | 33K | |
| Devil Diver (1984)(DK'Tronics).tzx | 16K | |
| Devil Rides In, The (1983)(Carnell Software).tzx | 6.3K | |
| Devil Rides In, The (1983)(Carnell Software)[a2].tzx | 6.3K | |
| Devil Rides In, The (1983)(Carnell Software)[a].tzx | 6.3K | |
| Devils Sceptre (19xx)(-).tzx | 39K | |
| Devils of the Deep (1983)(Richard Shepherd Software).tzx | 48K | |
| Devils of the Deep (1983)(Richard Shepherd Software)[a].tzx | 48K | |
| Di-Lithium Lift (1983)(Hewson Consultants)(16k).tzx | 8.7K | |
| Diablo! (1988)(Nebula Design Software)(128k)(Part 1 of 3).tzx | 112K | |
| Diablo! (1988)(Nebula Design Software)(128k)(Part 2 of 3).tzx | 102K | |
| Diablo! (1988)(Nebula Design Software)(128k)(Part 3 of 3).tzx | 103K | |
| Diablo! (1988)(Nebula Design Software)(Part 1 of 3).tzx | 52K | |
| Diablo! (1988)(Nebula Design Software)(Part 2 of 3).tzx | 52K | |
| Diablo! (1988)(Nebula Design Software)(Part 3 of 3).tzx | 52K | |
| Diablo! (1988)(Zenobi Software)(Side A)[re-release].tzx | 45K | |
| Diablo! (1988)(Zenobi Software)(Side B)[re-release].tzx | 89K | |
| Diamond (1988)(Destiny Software).tzx | 26K | |
| Diamond (1988)(Destiny Software)[a].tzx | 38K | |
| Diamond Trail (1983)(Gilsoft International).tzx | 16K | |
| Diamond Trail (1983)(Gilsoft International)[a2].tzx | 23K | |
| Diamond Trail (1983)(Gilsoft International)[a3].tzx | 24K | |
| Diamond Trail (1983)(Gilsoft International)[a].tzx | 24K | |
| Diamonds (1986)(Bill Gilbert).tzx | 16K | |
| Diamonds, The (1986)(Steve Brown).tzx | 15K | |
| Diarmid (1993)(Zenobi Software)(Side A).tzx | 39K | |
| Diarmid (1993)(Zenobi Software)(Side B).tzx | 38K | |
| Dice (1983)(EMM Software)(de).tzx | 14K | |
| Dick Tracy (1990)(Proein Soft Line)[re-release].tzx | 91K | |
| Dick Tracy (1990)(Titus).tzx | 91K | |
| Dick Tracy (1990)(Titus)[a].tzx | 91K | |
| Dick Tracy (1990)(Titus)[h].tzx | 87K | |
| Dick Turpin (1985)(B_J_ Curtis)(Side A).tzx | 47K | |
| Dick Turpin (1985)(B_J_ Curtis)(Side B).tzx | 46K | |
| Dickie Diver (1983)(Quickbeam Software).tzx | 15K | |
| Dictador, El (1983)(DK'Tronics)(es)[aka Dictator].tzx | 25K | |
| Dictator (1983)(DK'Tronics).tzx | 25K | |
| Dictator (1984)(ABC Soft)[re-release].tzx | 25K | |
| Die Alien Slime (1989)(Mastertronic Plus).tzx | 40K | |
| Die Alien Slime (1989)(Mastertronic Plus)[a].tzx | 40K | |
| Die Feuerfaust - The Fist of Fire (1995)(FSF Adventures)(Side A).tzx | 74K | |
| Die Feuerfaust - The Fist of Fire (1995)(FSF Adventures)(Side B).tzx | 74K | |
| Digger Dan (1983)(Ocean Software).tzx | 15K | |
| Digger Dan (1983)(Ocean Software)[a2].tzx | 15K | |
| Digger Dan (1983)(Ocean Software)[a].tzx | 15K | |
| Dimension Destructors (1983)(Artic Computing).tzx | 16K | |
| Dimension Destructors (1983)(Artic Computing)[a2].tzx | 16K | |
| Dimension Destructors (1983)(Artic Computing)[a3].tzx | 16K | |
| Dimension Destructors (1983)(Artic Computing)[a].tzx | 16K | |
| Dimension Omega (1989)(Positive)(48-128k)(es)(Side A).tzx | 46K | |
| Dimension Omega (1989)(Positive)(48-128k)(es)(Side B).tzx | 47K | |
| Dining (19xx)(-).tzx | 9.1K | |
| Dinky Digger (1983)(Postern).tzx | 42K | |
| Dinky Digger (1983)(Postern)[a].tzx | 42K | |
| Direct Current Electricity (1983)(SciCAL Software).tzx | 38K | |
| Dirt Track Racer (1991)(Zeppelin Games).tzx | 41K | |
| Dirt Track Racer (1991)(Zeppelin Games)[master tape].tzx | 47K | |
| Disco Dan (1984)(Gem Software).tzx | 20K | |
| Disco Dan (1986)(Sinclair Research)[a2][re-release].tzx | 19K | |
| Disco Dan (1986)(Sinclair Research)[a][re-release].tzx | 19K | |
| Disco Dan (1986)(Sinclair Research)[re-release].tzx | 19K | |
| Discs of Death (1985)(Artic Computing).tzx | 28K | |
| Discs of Death (1985)(Artic Computing)[a].tzx | 28K | |
| Discs of Death (1985)(Tynesoft)[re-release].tzx | 28K | |
| Disposable Heroes (1987)(The Power House).tzx | 44K | |
| Dizzy 'A' (2000)(N-Discovery)(128k)(ru).tzx | 45K | |
| Dizzy 'B' - Treasure Island (2001)(Yuri Nazarenko)(128k)(ru).tzx | 62K | |
| Dizzy CS (1993)(+Gama Software)(cz).tzx | 27K | |
| Dizzy Dice (1986)(Players Software).tzx | 47K | |
| Dizzy Help (1992)(Alexander Belousov)(ru).tzx | 33K | |
| Dizzy II - Treasure Island Dizzy (1988)(Codemasters).tzx | 56K | |
| Dizzy II - Treasure Island Dizzy (1988)(Codemasters)[a].tzx | 56K | |
| Dizzy III - Fantasy World Dizzy (1989)(Codemasters).tzx | 63K | |
| Dizzy III - Fantasy World Dizzy (1989)(Codemasters)[a].tzx | 63K | |
| Dizzy V - Spellbound Dizzy (1991)(Codemasters)(128k).tzx | 95K | |
| Dizzy VI - Prince of the Yolkfolk (1991)(Codemasters).tzx | 46K | |
| Dizzy VII - Crystal Kingdom Dizzy (1992)(Codemasters)(pre-release).tzx | 54K | |
| Dizzy VII - Crystal Kingdom Dizzy (1992)(Codemasters).tzx | 54K | |
| Dizzy VII - Crystal Kingdom Dizzy (1992)(Codemasters)[a2].tzx | 54K | |
| Dizzy VII - Crystal Kingdom Dizzy (1992)(Codemasters)[a].tzx | 54K | |
| Dizzy X - Part 1 - Journey to Russia (1995)(Speed Code)(128k)(ru).tzx | 70K | |
| Dizzy X - Part 2 - Return to Russia (1995)(Speed Code)(128k)(ru).tzx | 110K | |
| Dizzy XII - Underground (2001)(Gogin)(128k).tzx | 91K | |
| Dj Puff's Volcanic Eruption (1992)(Codemasters).tzx | 57K | |
| Djevojka sa Zapada - The Western Girl (1988)(Suzy Soft)(cs).tzx | 43K | |
| Djevojka sa Zapada - The Western Girl (1988)(Suzy Soft)(cs)[h].tzx | 43K | |
| Djevojka sa Zapada - The Western Girl (1988)(Suzy Soft)(cs)[h][a].tzx | 46K | |
| Do-Do & the Sno-Bees (1983)(Blaby Computer Games).tzx | 30K | |
| Do-Do & the Sno-Bees (1983)(Blaby Computer Games)[a].tzx | 31K | |
| Do-Do & the Sno-Bees (1983)(Prism Leisure)[re-release].tzx | 31K | |
| Do Not Pass Go (1982)(Riko Data)[re-release].tzx | 29K | |
| Do Not Pass Go (1982)(Work Force).tzx | 30K | |
| Doc the Destroyer (1987)(Melbourne House).tzx | 48K | |
| Doctor Goo and the Samorons (1991)(Global Games)(Side A).tzx | 120K | |
| Doctor Goo and the Samorons (1991)(Global Games)(Side B).tzx | 80K | |
| Doctor What! (1986)(CRL Group).tzx | 47K | |
| Doctor What! (1986)(CRL Group)[a].tzx | 47K | |
| Dodge City - Action Game (1983)(Phoenix Software).tzx | 32K | |
| Dodge City - Adventure Game (1983)(Phoenix Software).tzx | 40K | |
| Dodgems (19xx)(P_ Tolland)(16k).tzx | 3.6K | |
| Dodgy's Castle (1999)(CSSCGC).tzx | 7.8K | |
| Dodgy Geezers (1986)(Melbourne House)(Side A).tzx | 47K | |
| Dodgy Geezers (1986)(Melbourne House)(Side B).tzx | 40K | |
| Dodgy Geezers (1986)(Melbourne House).tzx | 87K | |
| Dog Weazle - The Megaventure (1986)(Alphasoft).tzx | 46K | |
| Dogboy, The (1985)(Zenobi Software)(Side A)[re-release].tzx | 38K | |
| Dogboy, The (1985)(Zenobi Software)(Side B)[re-release].tzx | 35K | |
| Dogboy, The (1992)(G_I_ Games)(Side A)[re-release].tzx | 37K | |
| Dogboy, The (1992)(G_I_ Games)(Side B)[re-release].tzx | 37K | |
| Dogfight (1984)(Fontana Publishing)(16k).tzx | 2.3K | |
| Dogfight 2187 (1987)(Starlight Software)(128k).tzx | 58K | |
| Dogsbody to the Rescue (1985)(Bug-Byte Software).tzx | 48K | |
| Dokonala Vrazda II - Bukapao (1991)(Ultrasoft)(sk).tzx | 49K | |
| Dollars in the Dust (1985)(Pelagon Software).tzx | 41K | |
| Dome Trooper (1986)(Matand Software).tzx | 48K | |
| Domes of Sha, The (1988)(River Software).tzx | 42K | |
| Domes of Sha, The (1988)(River Software)[a2].tzx | 42K | |
| Domes of Sha, The (1988)(River Software)[a].tzx | 42K | |
| Dominator (1989)(Electric Dreams Software)[SpeedLock 7].tzx | 88K | |
| Dominator (1989)(Electric Dreams Software)[a][SpeedLock 7].tzx | 88K | |
| Dominator (1989)(MCM Software)[re-release].tzx | 85K | |
| Domine (19xx)(Moj Mikro)(hr).tzx | 19K | |
| Dominetris (2005)(Cronosoft).tzx | 9.2K | |
| Domino (1985)(ABC Soft)(es).tzx | 22K | |
| Dominoes (1983)(CCS).tzx | 17K | |
| Dominoes (1983)(Micromega)(16k).tzx | 7.6K | |
| Dominoes (1983)(Phipps Associates)(16k).tzx | 23K | |
| Dominoes (1983)(Phipps Associates).tzx | 33K | |
| Dominoes (1988)(CDS Microsystems).tzx | 30K | |
| Dominoes (1988)(CDS Microsystems)[a2].tzx | 30K | |
| Dominoes (1988)(CDS Microsystems)[a].tzx | 30K | |
| Don't Panic (1985)(Firebird Software).tzx | 16K | |
| Don't Panic (1985)(Firebird Software)[cr Rony].tzx | 18K | |
| Don't Say It, Spray It (1988)(Pirate Software).tzx | 42K | |
| Don Quijote (1987)(Dinamic Software)(es)(Side A).tzx | 48K | |
| Don Quijote (1987)(Dinamic Software)(es)(Side A)[a2].tzx | 48K | |
| Don Quijote (1987)(Dinamic Software)(es)(Side A)[a].tzx | 48K | |
| Don Quijote (1987)(Dinamic Software)(es)(Side B).tzx | 48K | |
| Don Quijote (1987)(Dinamic Software)(es)(Side B)[a].tzx | 48K | |
| Donkey Kong (1986)(Ocean Software).tzx | 51K | |
| Donkey Kong (1986)(Ocean Software)[a].tzx | 51K | |
| Donkey Kong (1986)(Ocean Software)[cr Bill Gilbert].tzx | 40K | |
| Donkey Kong (1987)(Erbe Software)[a2][re-release].tzx | 50K | |
| Donkey Kong (1987)(Erbe Software)[a][re-release].tzx | 50K | |
| Donkey Kong (1987)(Erbe Software)[re-release].tzx | 50K | |
| Doolhof (1984)(Book)(nl).tzx | 7.0K | |
| Doombase (1986)(Sparklers).tzx | 37K | |
| Doombase (1988)(System 4)[re-release].tzx | 37K | |
| Doomdark's Revenge (1985)(Beyond Software).tzx | 49K | |
| Doomdark's Revenge (1985)(Beyond Software)[a2].tzx | 49K | |
| Doomdark's Revenge (1985)(Beyond Software)[a3].tzx | 49K | |
| Doomdark's Revenge (1985)(Beyond Software)[a4].tzx | 49K | |
| Doomdark's Revenge (1985)(Beyond Software)[a].tzx | 49K | |
| Doomdark's Revenge - Editor v3 (1997)(PDT).tzx | 31K | |
| Doomdark's Revenge - Editor v3a (1997)(PDT).tzx | 31K | |
| Doomsday (1991)(Relion Software)(128k).tzx | 116K | |
| Doomsday Castle (1983)(Fantasy Software).tzx | 38K | |
| Doomsday Castle (1983)(Fantasy Software)[a].tzx | 38K | |
| Doomsday Papers, The v2 (1986)(Matand Software).tzx | 45K | |
| Doomsday Papers, The v4 (1986)(Matand Software).tzx | 46K | |
| Doomsday Papers, The v5 (1986)(Matand Software).tzx | 47K | |
| Doomsday Papers, The v5 (1986)(Matand Software)[a].tzx | 47K | |
| Dotty (1984)(Dollarsoft).tzx | 44K | |
| Dotty (1984)(Dollarsoft)[a].tzx | 44K | |
| Double, The (1987)(Scanatron).tzx | 48K | |
| Double, The (1987)(Scanatron)[a].tzx | 51K | |
| Double, The (1987)(Summit Software)[re-release].tzx | 51K | |
| Double Agent (1987)(Tartan Software).tzx | 46K | |
| Double Agent (1987)(Tartan Software)[a].tzx | 46K | |
| Double Dare (1991)(Alternative Software).tzx | 94K | |
| Double Dare (1991)(Alternative Software)[a].tzx | 94K | |
| Double Dash (1990)(Proxima Software)(128k)(cz).tzx | 32K | |
| Double Dash (1990)(Proxima Software).tzx | 32K | |
| Double Dragon (1988)(Mastertronic Plus).tzx | 167K | |
| Double Dragon (1988)(Mastertronic Plus)[a2].tzx | 168K | |
| Double Dragon (1988)(Mastertronic Plus)[a3].tzx | 168K | |
| Double Dragon (1988)(Mastertronic Plus)[a].tzx | 168K | |
| Double Dragon (1989)(Dro Soft)[re-release].tzx | 168K | |
| Double Dragon II - The Revenge (1989)(Tronix)(128k)[re-release].tzx | 174K | |
| Double Dragon II - The Revenge (1989)(Virgin Mastertronic)(128k).tzx | 182K | |
| Double Dragon II - The Revenge (1989)(Virgin Mastertronic).tzx | 184K | |
| Double Dragon II - The Revenge (1990)(Dro Soft)(128k)(es)[a][re-rel..> | 175K | |
| Double Dragon II - The Revenge (1990)(Dro Soft)(128k)(es)[re-releas..> | 175K | |
| Double Dragon II - The Revenge (1990)(Dro Soft)(es)[a][re-release].tzx | 177K | |
| Double Dragon II - The Revenge (1990)(Dro Soft)(es)[re-release].tzx | 177K | |
| Double Dragon III - The Rosetta Stone (1991)(Storm Software)(128k)(..> | 25K | |
| Double Dragon III - The Rosetta Stone (1991)(Storm Software)(128k)(..> | 281K | |
| Double Dragon III - The Rosetta Stone (1991)(Storm Software)(128k)(..> | 273K | |
| Double Dragon III - The Rosetta Stone (1991)(Storm Software)(128k).tzx | 305K | |
| Double Take (1986)(Erbe Software)[re-release].tzx | 50K | |
| Double Take (1986)(Ocean Software).tzx | 37K | |
| Double Take (1986)(Ocean Software)[a2].tzx | 47K | |
| Double Take (1986)(Ocean Software)[a].tzx | 50K | |
| Double Xinox (1996)(ZX-Masters Software)(128k).tzx | 512K | |
| Down Town (1991)(Atlantis Software).tzx | 47K | |
| Down Town (1991)(Atlantis Software)[a].tzx | 47K | |
| Down Under (1984)(Hansesoft)(de).tzx | 50K | |
| Down Under (1984)(Hansesoft)(de)[a].tzx | 50K | |
| Downhill Champion (1988)(Lambourne Games).tzx | 43K | |
| Down to Earth (1987)(Firebird Software).tzx | 54K | |
| Dr_ Doom's Revenge (1989)(Empire Software).tzx | 195K | |
| Dr_ Doom's Revenge (1989)(Empire Software)[a].tzx | 195K | |
| Dr_ Franky and the Monster (1984)(Virgin Games).tzx | 48K | |
| Dr_ Franky and the Monster (1984)(Virgin Games)[a].tzx | 47K | |
| Dr_ Genius (1984)(Loriciels)(fr).tzx | 40K | |
| Dr_ Jackle and Mr_ Wide (1987)(Bulldog).tzx | 46K | |
| Dr_ Jackle and Mr_ Wide (1987)(Bulldog)[a].tzx | 46K | |
| Dr_ Jekyll and Mr_ Hyde (1988)(Essential Myth)(Side A).tzx | 92K | |
| Dr_ Jekyll and Mr_ Hyde (1988)(Essential Myth)(Side B).tzx | 85K | |
| Dr_ Jekyll and Mr_ Hyde (1988)(Zenobi Software)(128k)(Side A)[re-re..> | 63K | |
| Dr_ Jekyll and Mr_ Hyde (1988)(Zenobi Software)(128k)(Side B)[re-re..> | 93K | |
| Dr_ Jekyll and Mr_ Hyde (1988)(Zenobi Software)(Side A)[re-release]..> | 92K | |
| Dr_ Jekyll and Mr_ Hyde (1988)(Zenobi Software)(Side B)[re-release]..> | 85K | |
| Dr_ Jekyll and Mr_ Hyde - Part 1 - Dichotomies (1988)(Essential Myt..> | 46K | |
| Dr_ Jekyll and Mr_ Hyde - Part 2 - Duplicity (1988)(Essential Myth)..> | 44K | |
| Dr_ Jekyll and Mr_ Hyde - Part 3 - Denouement (1988)(Essential Myth..> | 40K | |
| Dr_ Jekyl und die Geheimformel (1985)(Potz Blitz)(de).tzx | 37K | |
| Dr_ Maddo (1986)(Americana Software)[re-release].tzx | 46K | |
| Dr_ Maddo (1986)(US Gold).tzx | 46K | |
| Dr_ Maddo (1986)(US Gold)[a].tzx | 46K | |
| Dr_ Who - Dalek Attack (1992)(Alternative Software)(128k).tzx | 117K | |
| Dr_ Who - Dalek Attack (1992)(Alternative Software)(128k)[a].tzx | 116K | |
| Dr_ Who - Dalek Attack (1992)(Alternative Software)(128k)[t].tzx | 117K | |
| Draconus (1988)(Zeppelin Games).tzx | 39K | |
| Draconus (1988)(Zeppelin Games)[a2].tzx | 39K | |
| Draconus (1988)(Zeppelin Games)[a3].tzx | 46K | |
| Draconus (1988)(Zeppelin Games)[a4].tzx | 46K | |
| Draconus (1988)(Zeppelin Games)[a].tzx | 46K | |
| Draconus (1988)(Zeppelin Games)[master tape].tzx | 47K | |
| Dracula - Part 1 - The First Night (1986)(CRL Group).tzx | 45K | |
| Dracula - Part 1 - The First Night (1986)(CRL Group)[a].tzx | 45K | |
| Dracula - Part 2 - The Arrival (1986)(CRL Group).tzx | 45K | |
| Dracula - Part 2 - The Arrival (1986)(CRL Group)[a].tzx | 45K | |
| Dracula - Part 3 - The Hunt (1986)(CRL Group).tzx | 45K | |
| Dracula - Part 3 - The Hunt (1986)(CRL Group)[a].tzx | 45K | |
| Dragnet Case, The (19xx)(-).tzx | 35K | |
| Dragon's Lair (1984)(Encore)[re-release].tzx | 94K | |
| Dragon's Lair (1984)(Software Projects).tzx | 94K | |
| Dragon's Lair (1984)(Software Projects)[a2].tzx | 152K | |
| Dragon's Lair (1984)(Software Projects)[a].tzx | 94K | |
| Dragon's Lair II - Escape from Singe's Castle (1987)(Encore)(128k)[..> | 95K | |
| Dragon's Lair II - Escape from Singe's Castle (1987)(Software Proje..> | 26K | |
| Dragon's Lair II - Escape from Singe's Castle (1987)(Software Proje..> | 69K | |
| Dragon's Lair II - Escape from Singe's Castle (1987)(Software Proje..> | 94K | |
| Dragon Breed (1989)(Activision)(Side A).tzx | 36K | |
| Dragon Breed (1989)(Activision)(Side B).tzx | 103K | |
| Dragon Breed (1989)(Activision)[t].tzx | 135K | |
| Dragon Ninja (1988)(Erbe Software)(128k)[re-release].tzx | 116K | |
| Dragon Ninja (1988)(Erbe Software)(128k)[small case][re-release].tzx | 116K | |
| Dragon Ninja (1988)(Erbe Software)[a][re-release].tzx | 99K | |
| Dragon Ninja (1988)(Erbe Software)[re-release].tzx | 99K | |
| Dragon Ninja (1988)(Erbe Software)[small case][re-release].tzx | 99K | |
| Dragon Ninja (1988)(Imagine Software)(128k).tzx | 120K | |
| Dragon Ninja (1988)(Imagine Software).tzx | 105K | |
| Dragon Ninja (1988)(Imagine Software)[a2].tzx | 215K | |
| Dragon Ninja (1988)(Imagine Software)[a].tzx | 106K | |
| Dragon Ninja (1988)(Imagine Software)[h].tzx | 93K | |
| Dragon Ninja (1988)(The Hit Squad)(128k)[re-release].tzx | 120K | |
| Dragon Ninja (1988)(The Hit Squad)[re-release].tzx | 106K | |
| Dragon Quest (1994)(Zenobi Software).tzx | 41K | |
| Dragon Slayer (1984)(Double Play Adventures).tzx | 32K | |
| Dragon Slayer (1992)(Dream World Adventures)(128k).tzx | 65K | |
| Dragon Slayer (1992)(Dream World Adventures)(Side A).tzx | 96K | |
| Dragon Slayer (1992)(Dream World Adventures)(Side B).tzx | 29K | |
| Dragon Spirit (1989)(Domark)(48-128k).tzx | 69K | |
| Dragon Spirit (1989)(Domark)(48-128k)[a].tzx | 161K | |
| Dragon Spirit (1989)(Domark)(48-128k)[m].tzx | 161K | |
| Dragon Spirit (1989)(The Hit Squad)(48-128k)[a][re-release].tzx | 161K | |
| Dragon Spirit (1989)(The Hit Squad)(48-128k)[re-release].tzx | 161K | |
| Dragon Star Trilogy, The (19xx)(Delta 4 Software)(Part 1 of 3).tzx | 34K | |
| Dragon Star Trilogy, The (19xx)(Delta 4 Software)(Part 2 of 3).tzx | 16K | |
| Dragon Star Trilogy, The (19xx)(Delta 4 Software)(Part 3 of 3).tzx | 40K | |
| Dragon Star Trilogy, The (1995)(G_I_ Games)(Part 1 of 3)[re-release..> | 35K | |
| Dragon Star Trilogy, The (1995)(G_I_ Games)(Part 2 of 3)[re-release..> | 16K | |
| Dragon Star Trilogy, The (1995)(G_I_ Games)(Part 3 of 3)[re-release..> | 40K | |
| Dragon Star Trilogy, The (1995)(G_I_ Games)(Side A)[re-release].tzx | 51K | |
| Dragon Star Trilogy, The (1995)(G_I_ Games)(Side B)[re-release].tzx | 40K | |
| Dragonfire (1984)(Cheetahsoft).tzx | 9.1K | |
| Dragonfire (1984)(Cheetahsoft)[a].tzx | 9.0K | |
| Dragonia (1988)(Astros Productions)(128k).tzx | 130K | |
| Dragonia (1988)(Astros Productions)(128k)[Multiface copy].tzx | 110K | |
| Dragon of Notacare, The (1986)(The Guild).tzx | 16K | |
| Dragonsbane (1983)(Quicksilva).tzx | 41K | |
| Dragonsbane (1983)(Quicksilva)[a].tzx | 41K | |
| Dragons of Flame (1990)(US Gold).tzx | 104K | |
| Dragons of Flame (1990)(US Gold)[m].tzx | 77K | |
| Dragontorc (1985)(Hewson Consultants)[a][passworded].tzx | 42K | |
| Dragontorc (1985)(Hewson Consultants)[passworded].tzx | 42K | |
| Drakkar (1989)(Delta Software)(es).tzx | 61K | |
| Drakmaze (1984)(Mikro-Gen).tzx | 35K | |
| Draughts (1983)(CRL Group).tzx | 15K | |
| Draughts (1984)(Oasis Software).tzx | 17K | |
| Draughts Genius (1987)(Rack-It).tzx | 39K | |
| Draughts Genius (1987)(Rack-It)[a2].tzx | 39K | |
| Draughts Genius (1987)(Rack-It)[a].tzx | 48K | |
| Draughts Master (1982)(CP Software).tzx | 17K | |
| Draughts Master (1982)(CP Software)[a].tzx | 17K | |
| Draughts v2 (1983)(P_ Macey).tzx | 32K | |
| Drazen Petrovic Basket (1989)(Topo Soft)(48-128k)(es).tzx | 63K | |
| Drazen Petrovic Basket (1989)(Topo Soft)(48-128k)(es)[a].tzx | 63K | |
| Dreadnoughts (1983)(MC Lothlorien).tzx | 46K | |
| Dreadnoughts (1983)(MC Lothlorien)[a].tzx | 46K | |
| Dream Warrior (1988)(US Gold)(128k).tzx | 52K | |
| Dream Warrior (1988)(US Gold).tzx | 52K | |
| Dream Warrior (1988)(US Gold)[a].tzx | 52K | |
| Dreamare (1991)(Global Games)(Side A).tzx | 42K | |
| Dreamare (1991)(Global Games)(Side B).tzx | 35K | |
| Driller (1987)(Erbe Software)[re-release].tzx | 48K | |
| Driller (1987)(Incentive Software).tzx | 55K | |
| Driller (1987)(Incentive Software)[a2].tzx | 51K | |
| Driller (1987)(Incentive Software)[a3].tzx | 54K | |
| Driller (1987)(Incentive Software)[a].tzx | 54K | |
| Driller (1987)(The Hit Squad)[re-release].tzx | 54K | |
| Driller Tanks (1983)(Sinclair Research).tzx | 11K | |
| Driller Tanks (1983)(Sinclair Research)[a].tzx | 11K | |
| Drinker, The (1986)(Suzy Soft)(cs).tzx | 55K | |
| Drive-In, The (1984)(Fantasy Software).tzx | 37K | |
| Droidz (1988)(Silverbird Software).tzx | 113K | |
| Dropout (1983)(Micro Press).tzx | 4.3K | |
| Drug Watch (1985)(Nottinghamshire Constabulary).tzx | 32K | |
| Druid (1986)(Firebird Software).tzx | 50K | |
| Druid (1986)(Firebird Software)[BleepLoad].tzx | 50K | |
| Druid II - Enlightenment (1986)(Firebird Software).tzx | 58K | |
| Druids Moon (1987)(Alternative Software).tzx | 41K | |
| Drunk Policeman (1985)(Automata UK).tzx | 25K | |
| Duck Out! (1989)(Dro Soft).tzx | 113K | |
| Duck Out! (1989)(Dro Soft)[a2].tzx | 106K | |
| Duck Out! (1989)(Dro Soft)[a].tzx | 113K | |
| Duct, The (1988)(Gremlin Graphics Software)(48-128k).tzx | 46K | |
| Duet - Commando '87 (1987)(Elite Systems).tzx | 46K | |
| Duet - Commando '87 (1987)(Elite Systems)[a].tzx | 46K | |
| Duggy (19xx)(-)(de).tzx | 5.3K | |
| Duke Bluebeard's Castle (1985)(M_42 Software).tzx | 47K | |
| Dukes of Hazzard (1985)(Elite Systems).tzx | 47K | |
| Dukes of Hazzard (1985)(Elite Systems)[a].tzx | 48K | |
| Dun Darach (1985)(Gargoyle Games).tzx | 45K | |
| Dun Darach (1985)(Gargoyle Games)[a].tzx | 45K | |
| Dun Darach (1985)(Rebound)[re-release].tzx | 45K | |
| Dun Darach (1988)(Dro Soft)[re-release].tzx | 45K | |
| Dungeon, The (1984)(Dave Newton).tzx | 39K | |
| Dungeon Dare (1986)(Central Solutions).tzx | 10K | |
| Dungeon Dare (1986)(Central Solutions)[a].tzx | 10K | |
| Dungeon Master, The v2 (1983)(Crystal Computing)(Side A).tzx | 36K | |
| Dungeon Master, The v2 (1983)(Crystal Computing)(Side A)[a].tzx | 36K | |
| Dungeon Master, The v2 (1983)(Crystal Computing)(Side B).tzx | 16K | |
| Dungeon Master, The v2 (1983)(Crystal Computing)(Side B)[a].tzx | 16K | |
| Dungeon of Torgar, The (19xx)(The Guild).tzx | 42K | |
| Dungeons & Dragons Character Creator (1986)(S_ Davis).tzx | 25K | |
| Dungeons (1983)(J_M_ Allen).tzx | 40K | |
| Dungeons of Doom (1984)(Temptation Software).tzx | 17K | |
| Dungeons of Maldread, The (1995)(Zenobi Software).tzx | 38K | |
| Dunlop 911TS (1985)(Elite Systems).tzx | 47K | |
| Dunshalt Donut, The (1984)(Anubis Software).tzx | 41K | |
| Dusk over Elfinton (1987)(Skyslip Software)(Side A).tzx | 45K | |
| Dusk over Elfinton (1987)(Skyslip Software)(Side B).tzx | 41K | |
| Dustin (1986)(Dinamic Software)(es).tzx | 45K | |
| Dustin (1986)(Dinamic Software)(es)[a].tzx | 47K | |
| Dustin (1986)(Dinamic Software)(es)[h].tzx | 46K | |
| Dustin (1988)(Hewson Consultants)[re-release].tzx | 46K | |
| Dusty Droid and the Garbage Gobblers (1988)(Pirate Software).tzx | 39K | |
| Dwarfs Domain (1984)(King Software).tzx | 41K | |
| Dwarfs Domain (1984)(King Software)[a].tzx | 40K | |
| Dyna Star (1988)(Pirate Software)(128k).tzx | 42K | |
| Dynamic Duo (1989)(Firebird Software).tzx | 48K | |
| Dynamic Duo (1989)(Firebird Software)[BleepLoad].tzx | 56K | |
| Dynamic Duo (1989)(Firebird Software)[a].tzx | 56K | |
| Dynamic Duo (1989)(MCM Software)[re-release].tzx | 56K | |
| Dynamite Dan (1985)(Mirrorsoft).tzx | 49K | |
| Dynamite Dan (1985)(Mirrorsoft)[a2].tzx | 49K | |
| Dynamite Dan (1985)(Mirrorsoft)[a3].tzx | 42K | |
| Dynamite Dan (1985)(Mirrorsoft)[a4].tzx | 48K | |
| Dynamite Dan (1985)(Mirrorsoft)[a].tzx | 49K | |
| Dynamite Dan (1985)(Mirrorsoft)[t +4].tzx | 50K | |
| Dynamite Dan (1985)(Silverbird Software)[re-release]_tzx.tzx | 44K | |
| Dynamite Dan (1988)(MCM Software)[re-release].tzx | 44K | |
| Dynamite Dan II - Dr_ Blitzen and the Islands of Arcanum (1986)(Mir..> | 45K | |
| Dynamite Dan II - Dr_ Blitzen and the Islands of Arcanum (1986)(Mir..> | 42K | |
| Dynamite Dan II - Dr_ Blitzen and the Islands of Arcanum (1986)(Mir..> | 46K | |
| Dynamite Dan II - Dr_ Blitzen and the Islands of Arcanum (1986)(Mir..> | 46K | |
| Dynamite Dan II - Dr_ Blitzen and the Islands of Arcanum (1986)(Mir..> | 48K | |
| Dynamite Dux (1989)(Activision)(48-128k)(Side A).tzx | 59K | |
| Dynamite Dux (1989)(Activision)(48-128k)(Side B).tzx | 86K | |
| Dynamite Dux (1989)(Activision)(48-128k).tzx | 145K | |
| Dynamite Dux (1989)(Activision)(48-128k)[b].tzx | 145K | |
| Dynamite Dux (1989)(Activision)(48-128k)[h].tzx | 147K | |
| Dynamix (1989)(Virgin Mastertronic).tzx | 48K | |
| Dynasty Wars (1990)(US Gold).tzx | 98K | |
| Dynatron Mission (1987)(Mastertronic).tzx | 47K | |
| Dzeta (1995)(Alexander Harlov)(ru).tzx | 42K | |
|
|---|