![[ICO]](/icons/blank.gif) | Name | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | |
![[ ]](/icons/unknown.gif) | R-Type (1988)(Electric Dreams Software)[b].z80 | 31K | |
| RTC Kings Cross (1986)(Dee Kay Systems).z80 | 36K | |
| RTC Penzance (1986)(Dee Kay Systems).z80 | 36K | |
| R_B_I_ 2 Baseball (1991)(Domark)(128k).z80 | 72K | |
| Rabbit Shoot (1983)(Phipps Associates)(Part 1 of 2).z80 | 7.2K | |
| Rabbit Shoot (1983)(Phipps Associates)(Part 1 of 2)[a].z80 | 7.2K | |
| Rabbit Shoot (1983)(Phipps Associates)(Part 2 of 2).z80 | 11K | |
| Race, The (1990)(Players Premier Software).z80 | 30K | |
| Race, The (1990)(Players Premier Software)[a].z80 | 30K | |
| Race Ace (1983)(Micro Gold)(16k).z80 | 9.5K | |
| Race Ace (1983)(Micro Gold)(16k)[a].z80 | 9.5K | |
| Race Against Time, The (1988)(Codemasters Plus).z80 | 43K | |
| Race Against Time, The (1988)(Codemasters Plus)[a2].z80 | 44K | |
| Race Against Time, The (1988)(Codemasters Plus)[a].z80 | 43K | |
| Race Fun (1983)(Rabbit Software).z80 | 9.4K | |
| Race Track (1982)(Sinclair Research).z80 | 9.8K | |
| Race Track (1982)(Sinclair Research)[a].z80 | 9.8K | |
| Racing Manager (1983)(Virgin Games).z80 | 36K | |
| Racing Manager (1983)(Virgin Games)[a].z80 | 36K | |
| Rad Ramp Racer (1990)(Mastertronic Plus).z80 | 25K | |
| Rad Ramp Racer (1990)(Mastertronic Plus)[a].z80 | 25K | |
| Radiomania (1991)(Zenobi Software).z80 | 41K | |
| Radiomania - Intro (1991)(Zenobi Software).z80 | 5.1K | |
| Raider of the Cursed Mine (1983)(Arcade Software).z80 | 21K | |
| Raider of the Cursed Mine (1983)(Arcade Software)[a].z80 | 22K | |
| Raiders (1983)(Cascade Games)(16k).z80 | 4.9K | |
| Raid on Lethos (1984)(Dave Newton).z80 | 40K | |
| Raid over Moscow (1985)(US Gold).z80 | 36K | |
| Raid over Moscow (1985)(US Gold)[a2].z80 | 36K | |
| Raid over Moscow (1985)(US Gold)[a].z80 | 37K | |
| Rainbow Islands - The Story of Bubble Bobble 2 (1990)(Ocean Softwar..> | 88K | |
| Rainbow Islands - The Story of Bubble Bobble 2 (1990)(Ocean Softwar..> | 81K | |
| Rainbow Islands - The Story of Bubble Bobble 2 (1990)(Ocean Softwar..> | 87K | |
| Rainbow Islands - The Story of Bubble Bobble 2 (1990)(Ocean Softwar..> | 31K | |
| Rainy Day (1984)(CCS).z80 | 29K | |
| Rainy Day (1984)(CCS)[speech].z80 | 29K | |
| Rally Cross Simulator (1990)(Codemasters).z80 | 38K | |
| Rally Driver (1984)(Hill MacGibbon).z80 | 36K | |
| Rally Driver (1984)(Hill MacGibbon)[a].z80 | 44K | |
| Rally Simulator (1989)(Zeppelin Games).z80 | 37K | |
| Rally Simulator (1989)(Zeppelin Games)[a].z80 | 37K | |
| Rambo (1985)(Ocean Software).z80 | 39K | |
| Rambo III (1988)(Ocean Software)(128k).z80 | 109K | |
| Ramon Rodriguez (1986)(Erbe Software)(es).z80 | 35K | |
| Rampage (1988)(Activision).z80 | 37K | |
| Rampage (1988)(Activision)[a].z80 | 37K | |
| Ramparts (1988)(Go!).z80 | 35K | |
| Ramparts (1988)(Go!)[a].z80 | 37K | |
| Rana Rama (1987)(Hewson Consultants).z80 | 38K | |
| Rancho (1984)(Idealogic)(es)[aka Ranch].z80 | 17K | |
| Randex (1994)(R_A_ Soft)(128k).z80 | 34K | |
| Random Attack (1985)(Micro-Engineering).z80 | 14K | |
| Random Attack (1985)(Micro-Engineering)[a2].z80 | 14K | |
| Random Attack (1985)(Micro-Engineering)[a].z80 | 14K | |
| Rapede - The Centipede's Revenge (1983)(Visions Software Factory).z80 | 7.6K | |
| Rapede - The Centipede's Revenge (1983)(Visions Software Factory)[a..> | 7.5K | |
| Rapid Fire (1987)(Mastertronic).z80 | 39K | |
| Rapid Fire (1987)(Mastertronic)[a2].z80 | 39K | |
| Rapid Fire (1987)(Mastertronic)[a].z80 | 35K | |
| Rapscallion (1984)(Bug-Byte Software).z80 | 41K | |
| Rapscallion (1984)(Bug-Byte Software)[a].z80 | 40K | |
| Rasputin (1986)(Firebird Software)(128k).z80 | 77K | |
| Rasputin (1986)(Firebird Software).z80 | 34K | |
| Rasputin (1986)(Firebird Software)[a].z80 | 30K | |
| Rastan (1988)(Imagine Software)(128k).z80 | 81K | |
| Raster Runner (1990)(Mastertronic Plus)(128k).z80 | 27K | |
| Rats, The (1985)(Hodder & Stoughton)[a][incomplete].z80 | 40K | |
| Rats, The (1985)(Hodder & Stoughton)[incomplete].z80 | 39K | |
| Rats, The - Intro (1985)(Hodder & Stoughton).z80 | 34K | |
| Rats, The - Intro (1985)(Hodder & Stoughton)[a].z80 | 34K | |
| Rattler (1985)(Atlantis Software).z80 | 25K | |
| Rattler (1985)(Atlantis Software)[a].z80 | 25K | |
| Raven, The (1988)(8th Day Software)(128k).z80 | 76K | |
| Raw Recruit (1988)(Mastertronic Added Dimension).z80 | 41K | |
| Raymond Pringle's Quest for the Fabled Jar of Pickled Cabbage (1992..> | 24K | |
| Rays (1987)(Tartan Software).z80 | 31K | |
| Reaction Tester (1995)(Vaxalon).z80 | 4.8K | |
| Reaction Time (1996)(CSSCGC).z80 | 2.2K | |
| Ready Steady Go (1988)(Alternative Software).z80 | 39K | |
| Really Smart Game (1999)(CSSCGC).z80 | 9.7K | |
| Realm, The (1986)(Cult Games).z80 | 40K | |
| Realm, The (1986)(Cult Games)[a2].z80 | 40K | |
| Realm, The (1986)(Cult Games)[a].z80 | 40K | |
| Realm of Darkness (1987)(Zenobi Software).z80 | 38K | |
| Realm of Darkness (1987)(Zenobi Software)[a].z80 | 38K | |
| Realm of Impossibility (1985)(Dro Soft)(es)[needs tape load][re-rel..> | 25K | |
| Realm of the Undead (1984)(MC Lothlorien)[re-release].z80 | 17K | |
| Reaper (1991)(Ubi Soft)(128k).z80 | 53K | |
| Rebel Planet (1986)(US Gold).z80 | 45K | |
| Rebel Planet (1986)(US Gold)[a2].z80 | 41K | |
| Rebel Planet (1986)(US Gold)[a3].z80 | 41K | |
| Rebel Planet (1986)(US Gold)[a].z80 | 41K | |
| Rebel Star - 1 Player (1986)(Firebird Software).z80 | 39K | |
| Rebel Star - 1 Player (1986)(Firebird Software)[a].z80 | 34K | |
| Rebel Star - 2 Players (1986)(Firebird Software).z80 | 41K | |
| Rebel Star - 2 Players (1986)(Firebird Software)[a2].z80 | 39K | |
| Rebel Star - 2 Players (1986)(Firebird Software)[a].z80 | 39K | |
| Rebel Star II - Alien Encounter - 1 Player (1988)(Silverbird Softwa..> | 40K | |
| Rebel Star II - Alien Encounter - 1 Player (1988)(Silverbird Softwa..> | 36K | |
| Rebel Star II - Alien Encounter - 1 Player (1988)(Silverbird Softwa..> | 40K | |
| Rebel Star II - Alien Encounter - 2 Players (1988)(Silverbird Softw..> | 34K | |
| Rebel Star II - Alien Encounter - 2 Players (1988)(Silverbird Softw..> | 35K | |
| Rebelstar Raiders - Scenario 1 - Moonbase (1984)(Red Shift).z80 | 32K | |
| Rebelstar Raiders - Scenario 1 - Moonbase (1984)(Red Shift)[a].z80 | 32K | |
| Reckless Rufus (1992)(Alternative Software)(128k).z80 | 43K | |
| Reckless Rufus (1992)(Alternative Software).z80 | 39K | |
| Reckless Rufus (1992)(Alternative Software)[a].z80 | 39K | |
| Recovery (1989)(Jioi Chabek)(cz).z80 | 32K | |
| Red Alert (1991)(Zenobi Software)(Part 1 of 2).z80 | 41K | |
| Red Alert (1991)(Zenobi Software)(Part 1 of 2)[a].z80 | 41K | |
| Red Alert (1991)(Zenobi Software)(Part 2 of 2).z80 | 42K | |
| Red Alert (1991)(Zenobi Software)(Part 2 of 2)[a].z80 | 42K | |
| Red Arrows (1985)(Database Software).z80 | 27K | |
| Red Arrows (1985)(Database Software)[a2].z80 | 25K | |
| Red Arrows (1985)(Database Software)[a3].z80 | 27K | |
| Red Arrows (1985)(Database Software)[a].z80 | 27K | |
| Red Attack (1984)(Unique).z80 | 8.2K | |
| Red Baron (1983)(MC Lothlorien).z80 | 35K | |
| Red Baron (1983)(MC Lothlorien)[a].z80 | 35K | |
| Red Door (1988)(Tartan Software).z80 | 40K | |
| Red Door (1988)(Tartan Software)[a2].z80 | 40K | |
| Red Door (1988)(Tartan Software)[a].z80 | 40K | |
| Red Heat (1989)(Ocean Software).z80 | 40K | |
| Red Lion, The (1987)(Mystic Software).z80 | 37K | |
| Red Scorpion (1987)(Quicksilva).z80 | 34K | |
| Red Scorpion (1987)(Quicksilva)[a2].z80 | 34K | |
| Red Scorpion (1987)(Quicksilva)[a3].z80 | 34K | |
| Red Scorpion (1987)(Quicksilva)[a].z80 | 34K | |
| Red Weed (1983)(MC Lothlorien).z80 | 23K | |
| Redcoats (1984)(MC Lothlorien).z80 | 28K | |
| Redhawk (1986)(Melbourne House).z80 | 42K | |
| Redhawk (1986)(Melbourne House)[a2].z80 | 35K | |
| Redhawk (1986)(Melbourne House)[a3].z80 | 42K | |
| Redhawk (1986)(Melbourne House)[a].z80 | 45K | |
| Redhawk II - Kwah! (1986)(Melbourne House).z80 | 40K | |
| Reflections (1983)(Artic Computing)(16k).z80 | 9.1K | |
| Reis-Staerke (1984)(Aquarius)(de)[aka Mr_ Wong's Loopy Laundry].z80 | 10K | |
| Reka (1986)(Colic)(cs).z80 | 8.0K | |
| Renegade (1987)(Imagine Software)(128k).z80 | 92K | |
| Renegade (1987)(Imagine Software)(128k)[a].z80 | 87K | |
| Renegade (1987)(Imagine Software).z80 | 41K | |
| Renegade (1987)(Imagine Software)[a2].z80 | 41K | |
| Renegade (1987)(Imagine Software)[a].z80 | 41K | |
| Renegade II - Target Renegade (1988)(Imagine Software)(128k).z80 | 106K | |
| Renegade II - Target Renegade (1988)(Imagine Software)(128k)[a2].z80 | 113K | |
| Renegade II - Target Renegade (1988)(Imagine Software)(128k)[a3].z80 | 108K | |
| Renegade II - Target Renegade (1988)(Imagine Software)(128k)[a4].z80 | 108K | |
| Renegade II - Target Renegade (1988)(Imagine Software)(128k)[a].z80 | 108K | |
| Renegade III - The Final Chapter (1989)(Imagine Software)(128k).z80 | 97K | |
| Renegade III - The Final Chapter (1989)(Imagine Software)(128k)[a2]..> | 92K | |
| Renegade III - The Final Chapter (1989)(Imagine Software)(128k)[a].z80 | 97K | |
| Rentakill Rita (1987)(Mastertronic).z80 | 38K | |
| Repton (1989)(Alligata Software).z80 | 36K | |
| Repton (1989)(Alligata Software)[b2].z80 | 33K | |
| Repton (1989)(Alligata Software)[b].z80 | 33K | |
| Repton 2 (1989)(Alligata Software)[b2].z80 | 35K | |
| Repton 2 (1989)(Alligata Software)[b].z80 | 35K | |
| Repulsar (1983)(Softek Software International)(16k).z80 | 9.3K | |
| Resaca (1990)(Alberto Vinuela)(es).z80 | 26K | |
| Rescate Atlantida (1989)(Dinamic Software)(128k)(es).z80 | 107K | |
| Rescate Atlantida (1989)(Dinamic Software)(es)(Part 1 of 2).z80 | 40K | |
| Rescate Atlantida (1989)(Dinamic Software)(es)(Part 2 of 2).z80 | 44K | |
| Rescate en el Golfo (1990)(Opera Soft)(Part 1 of 2).z80 | 33K | |
| Rescate en el Golfo (1990)(Opera Soft)(Part 1 of 2)[a].z80 | 33K | |
| Rescate en el Golfo (1990)(Opera Soft)(Part 2 of 2).z80 | 35K | |
| Rescate en el Golfo (1990)(Opera Soft)(Part 2 of 2)[a].z80 | 34K | |
| Rescue (1987)(Mastertronic).z80 | 37K | |
| Rescue (1987)(Mastertronic)[a].z80 | 41K | |
| Rescue - Intro (1982)(CRL Group).z80 | 12K | |
| Rescue - Intro (1982)(CRL Group)[a].z80 | 12K | |
| Rescue from Doom (1986)(The Guild).z80 | 25K | |
| Rescue on Fractalus (1986)(Activision).z80 | 35K | |
| Rescue on Fractalus (1986)(Activision)[a2].z80 | 36K | |
| Rescue on Fractalus (1986)(Activision)[a].z80 | 35K | |
| Retarded Creatures & Caverns (1989)(Zenobi Software).z80 | 42K | |
| Retarded Creatures & Caverns (1989)(Zenobi Software)[a].z80 | 38K | |
| Return of the Holy Joystick (1984)(Delta 4 Software).z80 | 42K | |
| Return of the Holy Joystick (1984)(Delta 4 Software)[a].z80 | 42K | |
| Return of the Jedi - Death Star Battle (1984)(Parker Software - Sin..> | 14K | |
| Return of the Jedi - Death Star Battle (1984)(Parker Software - Sin..> | 14K | |
| Return to Earth (1982)(Saturnsoft)(16k).z80 | 11K | |
| Return to Earth (1982)(Saturnsoft)(16k)[a].z80 | 11K | |
| Return to Ithaca (1985)(Atlantis Software).z80 | 41K | |
| Return to Ithaca (1985)(Atlantis Software)[a2].z80 | 41K | |
| Return to Ithaca (1985)(Atlantis Software)[a].z80 | 42K | |
| Return to Oz (1986)(US Gold).z80 | 37K | |
| Return to Oz (1986)(US Gold)[a].z80 | 37K | |
| Reveal (1989)(Mastertronic).z80 | 20K | |
| Reveal (1989)(Mastertronic)[a].z80 | 20K | |
| Revenge of the C5 (1985)(Atlantis Software).z80 | 33K | |
| Revenge of the Killer Tomatoes (1984)(Visions Software Factory).z80 | 33K | |
| Revenge of the Space Pirates - Part 1 - Daris (1994)(FSF Adventures..> | 37K | |
| Revenge of the Space Pirates - Part 2 - Waystar (1994)(FSF Adventur..> | 37K | |
| Reversi (1982)(Sinclair Research)(16k).z80 | 8.3K | |
| Reversi (1982)(Sinclair Research)(16k)[a].z80 | 8.3K | |
| Reversor (1983)(Peter Witzgall)(de).z80 | 9.7K | |
| Revolution (1986)(US Gold).z80 | 34K | |
| Revolution (1986)(US Gold)[a].z80 | 35K | |
| Revolver (1988)(Alternative Software).z80 | 35K | |
| Rex (1988)(Martech Games)(128k).z80 | 54K | |
| Rex (1988)(Martech Games)(Part 1 of 2).z80 | 43K | |
| Rex (1988)(Martech Games)(Part 2 of 2).z80 | 40K | |
| Rex Hard (1987)(Mister Chip)(es).z80 | 45K | |
| Reyes y Castillos (1984)(Special Soft)(es).z80 | 29K | |
| Rhyme Cryme (1996)(Zenobi Software)(128k).z80 | 50K | |
| Rick Dangerous (1989)(Firebird Software)(128k)[t].z80 | 45K | |
| Rick Dangerous (1989)(Firebird Software).z80 | 39K | |
| Rick Dangerous (1989)(Firebird Software)[a].z80 | 39K | |
| Ricochet (1987)(Firebird Software).z80 | 32K | |
| Riddler's Den (1985)(Electric Dreams Software).z80 | 33K | |
| Riddler's Den (1985)(Electric Dreams Software)[a].z80 | 33K | |
| Rider - Intro (1983)(Virgin Games).z80 | 4.9K | |
| Riding the Rapids (1987)(Players Software).z80 | 33K | |
| Riding the Rapids (1987)(Players Software)[a].z80 | 34K | |
| Rifle Range (1984)(Mastertronic).z80 | 12K | |
| Rifle Range - Intro (1984)(Mastertronic).z80 | 4.5K | |
| Rifts of Time, The (1984)(Pocket Money Software).z80 | 22K | |
| Rigel's Revenge (1987)(Bulldog)(Part 1 of 2).z80 | 41K | |
| Rigel's Revenge (1987)(Bulldog)(Part 1 of 2)[a].z80 | 41K | |
| Rigel's Revenge (1987)(Bulldog)(Part 2 of 2).z80 | 40K | |
| Rigel's Revenge (1987)(Bulldog)(Part 2 of 2)[a].z80 | 40K | |
| Rik the Roadie (1988)(Alternative Software).z80 | 19K | |
| Ring Master (19xx)(-).z80 | 34K | |
| Ring Master (19xx)(-)[a].z80 | 34K | |
| Ring Quest (19xx)(Uburrg Software).z80 | 40K | |
| Ring Wars (1989)(Cascade Games).z80 | 37K | |
| Ring of Darkness, The (1983)(Wintersoft)[needs tape load].z80 | 20K | |
| Rings of Saturn, The (19xx)(-).z80 | 42K | |
| River Raid (1984)(Activision).z80 | 34K | |
| River Rescue (1984)(Thorn Emi Video).z80 | 10K | |
| Road Blasters (1988)(US Gold)(128k).z80 | 97K | |
| Road Blasters (1988)(US Gold)(128k)[a2].z80 | 96K | |
| Road Blasters (1988)(US Gold)(128k)[a].z80 | 38K | |
| Road Frog (1983)(Spectrum Games)(16k).z80 | 6.4K | |
| Road Racer (1983)(Hyperion Software).z80 | 12K | |
| Road Racers (1983)(Artic Computing).z80 | 9.3K | |
| Road Racers (1983)(Artic Computing)[a].z80 | 9.1K | |
| Road Runner (1983)(Protek Computing).z80 | 6.4K | |
| Road Runner (1985)(US Gold).z80 | 44K | |
| Road Runner and Wile E_ Coyote (1991)(Hi-Tec Software).z80 | 32K | |
| Road Toad (1983)(Elfin Software)(16k).z80 | 10K | |
| Road Wars (1987)(Melbourne House).z80 | 37K | |
| Road Wars (1987)(Melbourne House)[a].z80 | 39K | |
| Roads of Plexar, The (1987)(Mastertronic Added Dimension).z80 | 42K | |
| Roads of Plexar, The (1987)(Mastertronic Added Dimension)[a2].z80 | 40K | |
| Roads of Plexar, The (1987)(Mastertronic Added Dimension)[a].z80 | 40K | |
| Robber (1983)(Virgin Games).z80 | 16K | |
| Robber (1983)(Virgin Games)[a].z80 | 16K | |
| Robbo (1997)(Amilton)(128k).z80 | 34K | |
| Robin Hood - Legend Quest (1993)(Codemasters).z80 | 38K | |
| Robin Smith's International Cricket (1990)(Challenge Software).z80 | 38K | |
| Robin of Sherlock (1985)(Silversoft)(Part 1 of 3).z80 | 43K | |
| Robin of Sherlock (1985)(Silversoft)(Part 1 of 3)[a].z80 | 43K | |
| Robin of Sherlock (1985)(Silversoft)(Part 2 of 3).z80 | 39K | |
| Robin of Sherlock (1985)(Silversoft)(Part 2 of 3)[a].z80 | 39K | |
| Robin of Sherlock (1985)(Silversoft)(Part 3 of 3).z80 | 40K | |
| Robin of Sherlock (1985)(Silversoft)(Part 3 of 3)[a].z80 | 40K | |
| Robin of Sherwood - The Touchstones of Rhiannon (1985)(Adventure In..> | 43K | |
| Robin of Sherwood - The Touchstones of Rhiannon (1985)(Adventure In..> | 41K | |
| Robin of Sherwood - The Touchstones of Rhiannon - Intro (1985)(Adve..> | 5.6K | |
| Robin of the Wood (1985)(Odin Computer Graphics)(128k).z80 | 61K | |
| Robin of the Wood (1985)(Odin Computer Graphics)(128k)[a].z80 | 61K | |
| Robin of the Wood (1985)(Odin Computer Graphics).z80 | 37K | |
| Robin of the Wood (1985)(Odin Computer Graphics)[kempston].z80 | 42K | |
| Robo Rumpus (1984)(Atlantis Software).z80 | 23K | |
| Robo Rumpus (1985)(Atlantis Software).z80 | 23K | |
| Robocop (1988)(Ocean Software)(128k).z80 | 115K | |
| Robocop (1988)(Ocean Software)(128k)[a].z80 | 111K | |
| Robocop 2 (1990)(Ocean Software)(128k).z80 | 114K | |
| Robocop 3 (1992)(Ocean Software)(128k).z80 | 107K | |
| Robon (1983)(Softek Software International).z80 | 11K | |
| Robot Attack (1989)(Mastertronic).z80 | 24K | |
| Robot Escape (1988)(SPE)(128k)(es).z80 | 36K | |
| Robot Escape (1988)(SPE)(es).z80 | 37K | |
| Robot Factory (1984)(Ventamatic)(es).z80 | 32K | |
| Robot Messiah (1985)(Alphabatim).z80 | 42K | |
| Robot Messiah (1985)(Alphabatim)[a2].z80 | 44K | |
| Robot Messiah (1985)(Alphabatim)[a].z80 | 42K | |
| Robot Riot (1983)(Silversoft).z80 | 26K | |
| Robot Riot (1983)(Silversoft)[a].z80 | 26K | |
| Robotank (19xx)(-).z80 | 12K | |
| Robotics (1984)(Ocean Software)(16k)[aka Frenzy].z80 | 6.0K | |
| Roboto (1985)(Bug-Byte Software).z80 | 40K | |
| Robotron (1984)(PAB).z80 | 9.8K | |
| Robotron (1984)(PAB)[a].z80 | 9.8K | |
| Robotron 2084 (1984)(Atarisoft).z80 | 35K | |
| Robyn Hode (1986)(ACD Software)(Part 1 of 2).z80 | 35K | |
| Robyn Hode (1986)(ACD Software)(Part 2 of 2).z80 | 34K | |
| Rocco (1985)(Gremlin Graphics Software)[aka Rocky].z80 | 37K | |
| Rock 'n Roller (1988)(Topo Soft)(es).z80 | 43K | |
| Rock 'n Roller (1988)(Topo Soft)(es)[a].z80 | 43K | |
| Rock 'n Wrestle (1985)(Melbourne House).z80 | 44K | |
| Rock Star Ate my Hamster (1989)(Codemasters)(128k)[t].z80 | 64K | |
| Rocket Raider (1983)(C-Tech)(16k).z80 | 9.6K | |
| Rockford (1988)(Mastertronic Added Dimension).z80 | 42K | |
| Rockford (1988)(Mastertronic Added Dimension)[a].z80 | 37K | |
| Rockman (1985)(Mastertronic).z80 | 37K | |
| Rockman (1985)(Mastertronic)[a].z80 | 37K | |
| Rocky (1985)(Dinamic Software).z80 | 37K | |
| Rocky Horror Show, The (1985)(CRL Group)(128k).z80 | 52K | |
| Rocky Horror Show, The (1985)(CRL Group).z80 | 43K | |
| Rocky Horror Show, The (1985)(CRL Group)[a].z80 | 43K | |
| Rocman (1986)(Magic Team)(es).z80 | 41K | |
| Rocman (1986)(Magic Team)(es)[a].z80 | 40K | |
| Rod-Land (1991)(Storm Software)(128k).z80 | 110K | |
| Rodent Run (2002)(Naffsoft).z80 | 7.2K | |
| Rogue (1988)(Mastertronic).z80 | 28K | |
| Rogue Trooper (1986)(Alternative Software)[m][re-release].z80 | 36K | |
| Rogue Trooper (1986)(Piranha).z80 | 37K | |
| Rogue Trooper (1986)(Piranha)[a2].z80 | 37K | |
| Rogue Trooper (1986)(Piranha)[a3].z80 | 40K | |
| Rogue Trooper (1986)(Piranha)[a].z80 | 38K | |
| Roland's Rat Race (1985)(Ocean Software).z80 | 34K | |
| Roland's Rat Race (1985)(Ocean Software)[a].z80 | 34K | |
| Roll'Em (2002)(Naffsoft).z80 | 6.4K | |
| Rollaround (1988)(Mastertronic).z80 | 27K | |
| Roller Coaster (1985)(Elite Systems).z80 | 41K | |
| Roller Coaster (1985)(Elite Systems)[a2].z80 | 38K | |
| Roller Coaster (1985)(Elite Systems)[a3].z80 | 41K | |
| Roller Coaster (1985)(Elite Systems)[a].z80 | 41K | |
| Rolling Thunder (1988)(US Gold).z80 | 40K | |
| Rolling Thunder (1988)(US Gold)[a].z80 | 40K | |
| Roman Empire (1982)(MC Lothlorien).z80 | 14K | |
| Rommel's Revenge (1983)(Crystal Computing).z80 | 29K | |
| Rommel's Revenge (1983)(Crystal Computing)[a2].z80 | 29K | |
| Rommel's Revenge (1983)(Crystal Computing)[a].z80 | 29K | |
| Ronnie Goes to Hollywood (1987)(8th Day Software).z80 | 43K | |
| Ronnie Goes to Hollywood (1987)(8th Day Software)[a].z80 | 43K | |
| Rookie (1989)(Mastertronic).z80 | 25K | |
| Room Ten (1986)(CRL Group).z80 | 25K | |
| Room Ten (1986)(CRL Group)[a].z80 | 25K | |
| Roulette (1982)(Dymond Software).z80 | 16K | |
| Roulette (1982)(Stefan Freise).z80 | 20K | |
| Roulette (1984)(Micromega)(16k).z80 | 11K | |
| Roulette (1984)(Micromega)(16k)[a].z80 | 8.6K | |
| Roundheads & Cavaliers (1987)(Argus Press Software).z80 | 29K | |
| Roundheads & Cavaliers (1987)(Argus Press Software)[a].z80 | 29K | |
| Round the Bend! (1991)(Zeppelin Games).z80 | 37K | |
| Rox III (1982)(Llamasoft)(16k).z80 | 10K | |
| Royal Adventures of a Common Frog (1985)(Automata UK).z80 | 41K | |
| Roy of the Rovers (1988)(Gremlin Graphics Software)(M4)(128k).z80 | 106K | |
| Rubicon (1987)(Bug-Byte Software).z80 | 33K | |
| Rubicon (1987)(Bug-Byte Software)[a].z80 | 33K | |
| Rubics Wurfel (1982)(-)(de)[aka Acme Glass Cube].z80 | 7.6K | |
| Ruby Runabout (1984)(Scorpio Software).z80 | 32K | |
| Ruby Runabout (1984)(Scorpio Software)[a].z80 | 32K | |
| Ruff and Reddy in The Space Adventure (1990)(Hi-Tec Software)(128k)..> | 42K | |
| Ruff and Reddy in The Space Adventure (1990)(Hi-Tec Software).z80 | 35K | |
| Ruff and Reddy in The Space Adventure (1990)(Hi-Tec Software)[a].z80 | 35K | |
| Rugby Coach (1991)(Cult Games).z80 | 36K | |
| Rugby Manager (1986)(Artic Computing).z80 | 40K | |
| Rugby Manager (1989)(Mastertronic Plus).z80 | 37K | |
| Run, Bronwynn, Run! (1992)(FSF Adventures)(Part 1 of 3).z80 | 36K | |
| Run, Bronwynn, Run! (1992)(FSF Adventures)(Part 2 of 3).z80 | 37K | |
| Run, Bronwynn, Run! (1992)(FSF Adventures)(Part 3 of 3).z80 | 37K | |
| Runes of Zendos, The (1984)(Dorcas Software).z80 | 38K | |
| Runes of Zendos, The (1984)(Dorcas Software)[a2].z80 | 38K | |
| Runes of Zendos, The (1984)(Dorcas Software)[a].z80 | 38K | |
| Runestone (1986)(Firebird Software).z80 | 38K | |
| Runestone of Zaobab, The (1988)(Eric Stewart).z80 | 40K | |
| Runestone of Zaobab, The (1988)(Eric Stewart)[a].z80 | 40K | |
| Run the Gauntlet (1989)(Ocean Software)(128k).z80 | 97K | |
| Rupert and the Ice Castle (1986)(Bug-Byte Software).z80 | 34K | |
| Rupert and the Ice Castle (1986)(Bug-Byte Software)[a2].z80 | 39K | |
| Rupert and the Ice Castle (1986)(Bug-Byte Software)[a].z80 | 39K | |
| Rupert and the Toymaker's Party (1985)(Quicksilva).z80 | 30K | |
| Rupert and the Toymaker's Party (1985)(Quicksilva)[a].z80 | 31K | |
| Rychle Sipy (1990)(MAJA Software - CID Software)(cz)(Part 1 of 2).z80 | 17K | |
| Rychle Sipy (1990)(MAJA Software - CID Software)(cz)(Part 2 of 2).z80 | 32K | |
| Rygar (1987)(US Gold)(128k).z80 | 30K | |
| Rygar (1987)(US Gold).z80 | 28K | |
| Rygar (1987)(US Gold)[a].z80 | 31K | |
|
|---|